C27H24N2O4 — CID 142489436
(3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one (PubChem CID 142489436) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 142489436 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methoxyphenyl)-2-oxoethyl]indol-2-one |
| SMILES | COc1ccccc1C(=O)C[C@]1(O)C(=O)N(CCc2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H24N2O4/c1-33-25-13-7-3-9-20(25)24(30)16-27(32)21-10-4-6-12-23(21)29(26(27)31)15-14-18-17-28-22-11-5-2-8-19(18)22/h2-13,17,28,32H,14-16H2,1H3/t27-/m1/s1 |
| InChIKey | LVDJEQBXZOISCF-HHHXNRCGSA-N |
| XLogP | 4.23 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |