C27H24N2O3 — CID 158110521
(3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methylphenyl)-2-oxoethyl]indol-2-one (PubChem CID 158110521) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methylphenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methylphenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 158110521 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (3R)-3-hydroxy-1-[2-(1H-indol-3-yl)ethyl]-3-[2-(2-methylphenyl)-2-oxoethyl]indol-2-one |
| SMILES | Cc1ccccc1C(=O)C[C@]1(O)C(=O)N(CCc2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H24N2O3/c1-18-8-2-3-9-20(18)25(30)16-27(32)22-11-5-7-13-24(22)29(26(27)31)15-14-19-17-28-23-12-6-4-10-21(19)23/h2-13,17,28,32H,14-16H2,1H3/t27-/m1/s1 |
| InChIKey | XOVZHPKJSHZIRS-HHHXNRCGSA-N |
| XLogP | 4.53 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |