C23H17F3N2O3S — CID 156569871
2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-4-fluoro-1-benzofuran-5-yl]methoxy]-5-fluorophenyl]ethanethioic S-acid (PubChem CID 156569871) has the molecular formula C23H17F3N2O3S and a molecular weight of 458.46 g/mol. Its IUPAC name is 2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-4-fluoro-1-benzofuran-5-yl]methoxy]-5-fluorophenyl]ethanethioic S-acid.
| Compound Name | 2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-4-fluoro-1-benzofuran-5-yl]methoxy]-5-fluorophenyl]ethanethioic S-acid |
|---|---|
| PubChem CID | 156569871 |
| Molecular Formula | C23H17F3N2O3S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-[2-[[7-[2-(aminomethyl)-3-fluoro-4-pyridinyl]-4-fluoro-1-benzofuran-5-yl]methoxy]-5-fluorophenyl]ethanethioic S-acid |
| SMILES | NCc1nccc(-c2cc(COc3ccc(F)cc3CC(=O)S)c(F)c3ccoc23)c1F |
| InChI | InChI=1S/C23H17F3N2O3S/c24-14-1-2-19(12(7-14)9-20(29)32)31-11-13-8-17(23-16(21(13)25)4-6-30-23)15-3-5-28-18(10-27)22(15)26/h1-8H,9-11,27H2,(H,29,32) |
| InChIKey | LHAMDBXZKFRDPJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|