C25H26N6O3S — CID 156569964
N-[2-[[4-(3-ethenyl-2-methoxy-5-phenylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 156569964) has the molecular formula C25H26N6O3S and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[2-[[4-(3-ethenyl-2-methoxy-5-phenylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[[4-(3-ethenyl-2-methoxy-5-phenylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 156569964 |
| Molecular Formula | C25H26N6O3S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-[2-[[4-(3-ethenyl-2-methoxy-5-phenylimidazol-4-yl)pyrimidin-2-yl]amino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | C=Cn1c(OC)nc(-c2ccccc2)c1-c1ccnc(NCCNS(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C25H26N6O3S/c1-4-31-23(22(30-25(31)34-3)19-8-6-5-7-9-19)21-14-15-26-24(29-21)27-16-17-28-35(32,33)20-12-10-18(2)11-13-20/h4-15,28H,1,16-17H2,2-3H3,(H,26,27,29) |
| InChIKey | XBFBQKRGGYTJEX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|