C19H22ClFN4OS — CID 156570206
(2S,4R)-4-amino-1-(3-chloro-4-fluoroanilino)-2-methyl-4-[4-(3-methylimidazol-4-yl)thiophen-2-yl]butan-1-ol (PubChem CID 156570206) has the molecular formula C19H22ClFN4OS and a molecular weight of 408.93 g/mol. Its IUPAC name is (2S,4R)-4-amino-1-(3-chloro-4-fluoroanilino)-2-methyl-4-[4-(3-methylimidazol-4-yl)thiophen-2-yl]butan-1-ol.
| Compound Name | (2S,4R)-4-amino-1-(3-chloro-4-fluoroanilino)-2-methyl-4-[4-(3-methylimidazol-4-yl)thiophen-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 156570206 |
| Molecular Formula | C19H22ClFN4OS |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (2S,4R)-4-amino-1-(3-chloro-4-fluoroanilino)-2-methyl-4-[4-(3-methylimidazol-4-yl)thiophen-2-yl]butan-1-ol |
| SMILES | C[C@@H](C[C@@H](N)c1cc(-c2cncn2C)cs1)C(O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN4OS/c1-11(19(26)24-13-3-4-15(21)14(20)7-13)5-16(22)18-6-12(9-27-18)17-8-23-10-25(17)2/h3-4,6-11,16,19,24,26H,5,22H2,1-2H3/t11-,16+,19?/m0/s1 |
| InChIKey | AMTALMLEHBISQI-QRWIJULXSA-N |
| XLogP | 4.40 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|