C7H6N6O — CID 156571670
1-amino-5H-imidazo[2,1-b]purin-4-one (PubChem CID 156571670) has the molecular formula C7H6N6O and a molecular weight of 190.17 g/mol. Its IUPAC name is 1-amino-5H-imidazo[2,1-b]purin-4-one.
| Compound Name | 1-amino-5H-imidazo[2,1-b]purin-4-one |
|---|---|
| PubChem CID | 156571670 |
| Molecular Formula | C7H6N6O |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1-amino-5H-imidazo[2,1-b]purin-4-one |
| SMILES | Nn1cnc2c(=O)[nH]c3nccn3c21 |
| InChI | InChI=1S/C7H6N6O/c8-13-3-10-4-5(14)11-7-9-1-2-12(7)6(4)13/h1-3H,8H2,(H,9,11,14) |
| InChIKey | FMPIRBMCJOFKLJ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |