C5H5N5O2 — CID 57025497
9-amino-3H-purine-2,6-dione (PubChem CID 57025497) has the molecular formula C5H5N5O2 and a molecular weight of 167.13 g/mol. Its IUPAC name is 9-amino-3H-purine-2,6-dione.
| Compound Name | 9-amino-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 57025497 |
| Molecular Formula | C5H5N5O2 |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 9-amino-3H-purine-2,6-dione |
| SMILES | Nn1cnc2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C5H5N5O2/c6-10-1-7-2-3(10)8-5(12)9-4(2)11/h1H,6H2,(H2,8,9,11,12) |
| InChIKey | VOGFVRSAYBIUEA-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |