C8H8N4O3 — CID 110171590
8-ethyl-1H-pteridine-2,4,7-trione (PubChem CID 110171590) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is 8-ethyl-1H-pteridine-2,4,7-trione.
| Compound Name | 8-ethyl-1H-pteridine-2,4,7-trione |
|---|---|
| PubChem CID | 110171590 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 8-ethyl-1H-pteridine-2,4,7-trione |
| SMILES | CCn1c(=O)cnc2c(=O)[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C8H8N4O3/c1-2-12-4(13)3-9-5-6(12)10-8(15)11-7(5)14/h3H,2H2,1H3,(H2,10,11,14,15) |
| InChIKey | QCPHENGMBNXUTH-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |