About 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione
7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 167186965) has the molecular formula C9H8BrN3O2
and a molecular weight of 270.09 g/mol. Its IUPAC name is 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione |
| PubChem CID | 167186965 |
| Molecular Formula | C9H8BrN3O2 |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c(=O)c2ncc(Br)cc21 |
| InChI | InChI=1S/C9H8BrN3O2/c1-2-13-6-3-5(10)4-11-7(6)8(14)12-9(13)15/h3-4H,2H2,1H3,(H,12,14,15) |
| InChIKey | OWFDHTFPEPBBRN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione?
The IUPAC name of 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione (CID 167186965) is 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione.
What is the SMILES notation for 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione?
The canonical SMILES for 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione is CCn1c(=O)[nH]c(=O)c2ncc(Br)cc21.
What is the InChIKey of 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione?
The InChIKey is OWFDHTFPEPBBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrN3O2/c1-2-13-6-3-5(10)4-11-7(6)8(14)12-9(13)15/h3-4H,2H2,1H3,(H,12,14,15).
What are the key properties of 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione?
7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione has a molecular weight of 270.09 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-ethylpyrido[3,2-d]pyrimidine-2,4-dione is sourced from PubChem (CID 167186965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).