C11H8FIN2O — CID 156572829
6-fluoro-7-iodo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one (PubChem CID 156572829) has the molecular formula C11H8FIN2O and a molecular weight of 330.10 g/mol. Its IUPAC name is 6-fluoro-7-iodo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | 6-fluoro-7-iodo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 156572829 |
| Molecular Formula | C11H8FIN2O |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 6-fluoro-7-iodo-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one |
| SMILES | O=c1c2cc(I)c(F)cc2nc2n1CCC2 |
| InChI | InChI=1S/C11H8FIN2O/c12-7-5-9-6(4-8(7)13)11(16)15-3-1-2-10(15)14-9/h4-5H,1-3H2 |
| InChIKey | LFRXRNXAROLXKG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|