C17H13F3N4O3S — CID 156574694
N-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(trifluoromethoxy)benzamide (PubChem CID 156574694) has the molecular formula C17H13F3N4O3S and a molecular weight of 410.38 g/mol. Its IUPAC name is N-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(trifluoromethoxy)benzamide.
| Compound Name | N-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 156574694 |
| Molecular Formula | C17H13F3N4O3S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | N-[[5-(2-methoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-(trifluoromethoxy)benzamide |
| SMILES | COc1ccccc1-c1nc(SNC(=O)c2ccccc2OC(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C17H13F3N4O3S/c1-26-12-8-4-2-6-10(12)14-21-16(23-22-14)28-24-15(25)11-7-3-5-9-13(11)27-17(18,19)20/h2-9H,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | VIBGXBRJGCWOAD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|