C15H20O3 — CID 156580350
(1R,3S,5S,8R,11R)-6-formyl-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3-carboxylic acid (PubChem CID 156580350) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,3S,5S,8R,11R)-6-formyl-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3-carboxylic acid.
| Compound Name | (1R,3S,5S,8R,11R)-6-formyl-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 156580350 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,3S,5S,8R,11R)-6-formyl-3,11-dimethyltricyclo[6.3.0.01,5]undec-6-ene-3-carboxylic acid |
| SMILES | C[C@@H]1CC[C@@H]2C=C(C=O)[C@H]3C[C@](C)(C(=O)O)C[C@]132 |
| InChI | InChI=1S/C15H20O3/c1-9-3-4-11-5-10(7-16)12-6-14(2,13(17)18)8-15(9,11)12/h5,7,9,11-12H,3-4,6,8H2,1-2H3,(H,17,18)/t9-,11-,12-,14+,15-/m1/s1 |
| InChIKey | KEBDLINYIUBWLK-MXMAQPRASA-N |
| XLogP | 2.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|