C21H25NO4 — CID 156580946
3-[(E,2S,4S)-2,4-dimethyloct-6-enoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one (PubChem CID 156580946) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 3-[(E,2S,4S)-2,4-dimethyloct-6-enoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one.
| Compound Name | 3-[(E,2S,4S)-2,4-dimethyloct-6-enoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 156580946 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[(E,2S,4S)-2,4-dimethyloct-6-enoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1H-pyridin-2-one |
| SMILES | C/C=C/C[C@H](C)C[C@H](C)C(=O)c1c(O)c(-c2ccc(O)cc2)c[nH]c1=O |
| InChI | InChI=1S/C21H25NO4/c1-4-5-6-13(2)11-14(3)19(24)18-20(25)17(12-22-21(18)26)15-7-9-16(23)10-8-15/h4-5,7-10,12-14,23H,6,11H2,1-3H3,(H2,22,25,26)/b5-4+/t13-,14-/m0/s1 |
| InChIKey | HLYMRXUSGGFLEA-CTXXGXLOSA-N |
| XLogP | 4.26 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|