C22H19NO5 — CID 156582144
(4bS)-11-amino-4,9-dihydroxy-2-methyl-4b-[(2R)-3-oxobutan-2-yl]benzo[b]fluorene-5,10-dione (PubChem CID 156582144) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is (4bS)-11-amino-4,9-dihydroxy-2-methyl-4b-[(2R)-3-oxobutan-2-yl]benzo[b]fluorene-5,10-dione.
| Compound Name | (4bS)-11-amino-4,9-dihydroxy-2-methyl-4b-[(2R)-3-oxobutan-2-yl]benzo[b]fluorene-5,10-dione |
|---|---|
| PubChem CID | 156582144 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (4bS)-11-amino-4,9-dihydroxy-2-methyl-4b-[(2R)-3-oxobutan-2-yl]benzo[b]fluorene-5,10-dione |
| SMILES | CC(=O)[C@H](C)[C@@]12C(=O)c3cccc(O)c3C(=O)C1=C(N)c1cc(C)cc(O)c12 |
| InChI | InChI=1S/C22H19NO5/c1-9-7-13-17(15(26)8-9)22(10(2)11(3)24)18(19(13)23)20(27)16-12(21(22)28)5-4-6-14(16)25/h4-8,10,25-26H,23H2,1-3H3/t10-,22-/m0/s1 |
| InChIKey | VWTRKHKFMBZAJC-MGUXCZDKSA-N |
| XLogP | 2.63 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|