C20H30O4 — CID 156582259
(2S,3S,3aS,4S,7S,7aS)-2-methoxy-2-methyl-4-[(1E,3E,5E)-7-methylnona-1,3,5-trienyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-3,7-diol (PubChem CID 156582259) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S,3S,3aS,4S,7S,7aS)-2-methoxy-2-methyl-4-[(1E,3E,5E)-7-methylnona-1,3,5-trienyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-3,7-diol.
| Compound Name | (2S,3S,3aS,4S,7S,7aS)-2-methoxy-2-methyl-4-[(1E,3E,5E)-7-methylnona-1,3,5-trienyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-3,7-diol |
|---|---|
| PubChem CID | 156582259 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2S,3S,3aS,4S,7S,7aS)-2-methoxy-2-methyl-4-[(1E,3E,5E)-7-methylnona-1,3,5-trienyl]-3a,4,7,7a-tetrahydro-3H-1-benzofuran-3,7-diol |
| SMILES | CCC(C)/C=C/C=C/C=C/[C@H]1C=C[C@H](O)[C@H]2O[C@](C)(OC)[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C20H30O4/c1-5-14(2)10-8-6-7-9-11-15-12-13-16(21)18-17(15)19(22)20(3,23-4)24-18/h6-19,21-22H,5H2,1-4H3/b7-6+,10-8+,11-9+/t14?,15-,16-,17+,18+,19-,20-/m0/s1 |
| InChIKey | LTZUEPASRMEDRQ-XZAFNVDMSA-N |
| XLogP | 2.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|