C16H30O5 — CID 156582491
(5R)-5-[(1R,4R,5R)-1,4,5-trihydroxydodecyl]oxolan-2-one (PubChem CID 156582491) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is (5R)-5-[(1R,4R,5R)-1,4,5-trihydroxydodecyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1R,4R,5R)-1,4,5-trihydroxydodecyl]oxolan-2-one |
|---|---|
| PubChem CID | 156582491 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (5R)-5-[(1R,4R,5R)-1,4,5-trihydroxydodecyl]oxolan-2-one |
| SMILES | CCCCCCC[C@@H](O)[C@H](O)CC[C@@H](O)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C16H30O5/c1-2-3-4-5-6-7-12(17)13(18)8-9-14(19)15-10-11-16(20)21-15/h12-15,17-19H,2-11H2,1H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | POXFJRZGYPIAOC-KBUPBQIOSA-N |
| XLogP | 1.92 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|