C30H50O4 — CID 156582623
(3S,5R,7R,10S,13R,14R,15S,17R)-17-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol (PubChem CID 156582623) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is (3S,5R,7R,10S,13R,14R,15S,17R)-17-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol.
| Compound Name | (3S,5R,7R,10S,13R,14R,15S,17R)-17-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol |
|---|---|
| PubChem CID | 156582623 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (3S,5R,7R,10S,13R,14R,15S,17R)-17-[(E,2R)-7-hydroxy-6-methylhept-5-en-2-yl]-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,7,15-triol |
| SMILES | C/C(=C\CC[C@@H](C)[C@H]1C[C@H](O)[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1C[C@H]3O)CO |
| InChI | InChI=1S/C30H50O4/c1-18(17-31)9-8-10-19(2)21-15-25(34)30(7)26-20(11-14-29(21,30)6)28(5)13-12-24(33)27(3,4)23(28)16-22(26)32/h9,19,21-25,31-34H,8,10-17H2,1-7H3/b18-9+/t19-,21-,22-,23+,24+,25+,28-,29-,30+/m1/s1 |
| InChIKey | BYIQRZZIFPXXKT-CRFDBSSISA-N |
| XLogP | 5.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|