C9H12ClN3O4 — CID 156588422
CID 156588422 (PubChem CID 156588422) has the molecular formula C9H12ClN3O4 and a molecular weight of 261.66 g/mol.
| Compound Name | CID 156588422 |
|---|---|
| PubChem CID | 156588422 |
| Molecular Formula | C9H12ClN3O4 |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | — |
| SMILES | Cl.Nc1ccn([C]2C[C](O)[C@@H](CO)O2)c(=O)n1 |
| InChI | InChI=1S/C9H11N3O4.ClH/c10-7-1-2-12(9(15)11-7)8-3-5(14)6(4-13)16-8;/h1-2,6,13-14H,3-4H2,(H2,10,11,15);1H/t6-;/m1./s1 |
| InChIKey | XPMNNPYYNAQVKN-FYZOBXCZSA-N |
| XLogP | -0.73 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |