C16H32O5Si — CID 15658844
(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-methoxyethoxymethoxy)hex-2-enal (PubChem CID 15658844) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-methoxyethoxymethoxy)hex-2-enal.
| Compound Name | (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-methoxyethoxymethoxy)hex-2-enal |
|---|---|
| PubChem CID | 15658844 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-methoxyethoxymethoxy)hex-2-enal |
| SMILES | COCCOCOCC[C@@H](/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-16(2,3)22(5,6)21-15(8-7-10-17)9-11-19-14-20-13-12-18-4/h7-8,10,15H,9,11-14H2,1-6H3/b8-7+/t15-/m1/s1 |
| InChIKey | GBZWXGNLLBIFOV-MVGZEHJDSA-N |
| XLogP | 3.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|