C20H18NaO11P2 — CID 156588820
C20H18NaO11P2 (PubChem CID 156588820) has the molecular formula C20H18NaO11P2 and a molecular weight of 519.29 g/mol.
| Compound Name | C20H18NaO11P2 |
|---|---|
| PubChem CID | 156588820 |
| Molecular Formula | C20H18NaO11P2 |
| Molecular Weight | 519.29 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccc1C(O)(c1ccc(OP(=O)(O)O)cc1)c1ccc(OP(=O)(O)O)cc1.[Na] |
| InChI | InChI=1S/C20H18O11P2.Na/c21-19(22)17-3-1-2-4-18(17)20(23,13-5-9-15(10-6-13)30-32(24,25)26)14-7-11-16(12-8-14)31-33(27,28)29;/h1-12,23H,(H,21,22)(H2,24,25,26)(H2,27,28,29); |
| InChIKey | VGGYELROSJINSJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|