C23H26FN5O5 — CID 156590970
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[8-(4-fluorophenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide (PubChem CID 156590970) has the molecular formula C23H26FN5O5 and a molecular weight of 471.49 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[8-(4-fluorophenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[8-(4-fluorophenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 156590970 |
| Molecular Formula | C23H26FN5O5 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[8-(4-fluorophenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide |
| SMILES | COc1ccc(CCNC(=O)CN2NC3N(CCN3c3ccc(F)cc3)C(=O)C2=O)cc1OC |
| InChI | InChI=1S/C23H26FN5O5/c1-33-18-8-3-15(13-19(18)34-2)9-10-25-20(30)14-29-22(32)21(31)28-12-11-27(23(28)26-29)17-6-4-16(24)5-7-17/h3-8,13,23,26H,9-12,14H2,1-2H3,(H,25,30) |
| InChIKey | FJTZLLPNOQPPLA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|