C26H37N3O5 — CID 156591805
2-[4-(3,4-dimethoxyphenyl)-5-methylpyrazolidin-3-yl]-5-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenol (PubChem CID 156591805) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)-5-methylpyrazolidin-3-yl]-5-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenol.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)-5-methylpyrazolidin-3-yl]-5-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenol |
|---|---|
| PubChem CID | 156591805 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)-5-methylpyrazolidin-3-yl]-5-[2-(2,6-dimethylmorpholin-4-yl)ethoxy]phenol |
| SMILES | COc1ccc(C2C(C)NNC2c2ccc(OCCN3CC(C)OC(C)C3)cc2O)cc1OC |
| InChI | InChI=1S/C26H37N3O5/c1-16-14-29(15-17(2)34-16)10-11-33-20-7-8-21(22(30)13-20)26-25(18(3)27-28-26)19-6-9-23(31-4)24(12-19)32-5/h6-9,12-13,16-18,25-28,30H,10-11,14-15H2,1-5H3 |
| InChIKey | JWWMNMBCMMMXIW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|