C19H27N8O7+ — CID 156593008
8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 156593008) has the molecular formula C19H27N8O7+ and a molecular weight of 479.47 g/mol. Its IUPAC name is 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 156593008 |
| Molecular Formula | C19H27N8O7+ |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC(C)OCC(O)C[N+]1=C(/N=N/c2c(O)n(C)c(=O)n(C)c2=O)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C19H26N8O7/c1-9(2)34-8-10(28)7-27-12-13(23(3)18(32)26(6)16(12)31)20-17(27)22-21-11-14(29)24(4)19(33)25(5)15(11)30/h9-10,12,28H,7-8H2,1-6H3/p+1 |
| InChIKey | NPBJXLRZGJRNNM-UHFFFAOYSA-O |
| XLogP | -1.67 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|