C16H21N8O6+ — CID 156590451
8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 156590451) has the molecular formula C16H21N8O6+ and a molecular weight of 421.39 g/mol. Its IUPAC name is 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 156590451 |
| Molecular Formula | C16H21N8O6+ |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC(O)C[N+]1=C(/N=N/c2c(O)n(C)c(=O)n(C)c2=O)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H20N8O6/c1-7(25)6-24-9-10(20(2)15(29)23(5)13(9)28)17-14(24)19-18-8-11(26)21(3)16(30)22(4)12(8)27/h7,9,25H,6H2,1-5H3/p+1 |
| InChIKey | AELVMYKSMFTJEH-UHFFFAOYSA-O |
| XLogP | -2.07 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|