C14H18N8O6 — CID 156593238
8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 156593238) has the molecular formula C14H18N8O6 and a molecular weight of 394.35 g/mol. Its IUPAC name is 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156593238 |
| Molecular Formula | C14H18N8O6 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-7-(2-hydroxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(/N=N/c1c(O)n(C)c(=O)n(C)c1=O)N2CCO |
| InChI | InChI=1S/C14H18N8O6/c1-19-8-7(9(24)16-13(19)27)22(4-5-23)12(15-8)18-17-6-10(25)20(2)14(28)21(3)11(6)26/h7-8,23,25H,4-5H2,1-3H3,(H,16,24,27)/b18-17+ |
| InChIKey | UPNOZGMQXJGHHA-ISLYRVAYSA-N |
| XLogP | -2.59 |
| TPSA | 174.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|