C15H20N8O7 — CID 156591487
7-(2,3-dihydroxypropyl)-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 156591487) has the molecular formula C15H20N8O7 and a molecular weight of 424.37 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 156591487 |
| Molecular Formula | C15H20N8O7 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-8-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)diazenyl]-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(/N=N/c1c(O)n(C)c(=O)n(C)c1=O)N2CC(O)CO |
| InChI | InChI=1S/C15H20N8O7/c1-20-9-8(10(26)17-14(20)29)23(4-6(25)5-24)13(16-9)19-18-7-11(27)21(2)15(30)22(3)12(7)28/h6,8-9,24-25,27H,4-5H2,1-3H3,(H,17,26,29)/b19-18+ |
| InChIKey | LVGDCLRZBXZDIQ-VHEBQXMUSA-N |
| XLogP | -3.23 |
| TPSA | 194.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|