C27H37NO9 — CID 156596519
2-[2-[2-[2-[[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 156596519) has the molecular formula C27H37NO9 and a molecular weight of 519.59 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 156596519 |
| Molecular Formula | C27H37NO9 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 2-[2-[2-[2-[[(4R,4aS,7S,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](OCCOCCOCCOCC(=O)O)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H37NO9/c1-2-8-28-9-7-26-23-18-3-4-19(29)24(23)37-25(26)20(5-6-27(26,32)21(28)16-18)36-15-14-34-11-10-33-12-13-35-17-22(30)31/h2-4,20-21,25,29,32H,1,5-17H2,(H,30,31)/t20-,21+,25-,26-,27+/m0/s1 |
| InChIKey | CKIMPNYBEIGDOE-ZVHMEQHSSA-N |
| XLogP | 1.25 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|