C13H17N7OS — CID 156597893
2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]acetohydrazide (PubChem CID 156597893) has the molecular formula C13H17N7OS and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]acetohydrazide.
| Compound Name | 2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 156597893 |
| Molecular Formula | C13H17N7OS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methylsulfanyl]acetohydrazide |
| SMILES | Cc1ccc(Nc2nc(N)nc(CSCC(=O)NN)n2)cc1 |
| InChI | InChI=1S/C13H17N7OS/c1-8-2-4-9(5-3-8)16-13-18-10(17-12(14)19-13)6-22-7-11(21)20-15/h2-5H,6-7,15H2,1H3,(H,20,21)(H3,14,16,17,18,19) |
| InChIKey | WGIMIWRKAJVXIQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|