C25H32N6O3S — CID 156600677
6-oxo-7-(2-propan-2-yl-4-pyridinyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600677) has the molecular formula C25H32N6O3S and a molecular weight of 496.64 g/mol. Its IUPAC name is 6-oxo-7-(2-propan-2-yl-4-pyridinyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 6-oxo-7-(2-propan-2-yl-4-pyridinyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600677 |
| Molecular Formula | C25H32N6O3S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 6-oxo-7-(2-propan-2-yl-4-pyridinyl)-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)C1=C2NC(=O)N(c3ccnc(C(C)C)c3)C3CCNC(S1)C23 |
| InChI | InChI=1S/C25H32N6O3S/c1-4-19(32)28-15-6-5-7-16(15)29-23(33)22-21-20-18(9-11-27-24(20)35-22)31(25(34)30-21)14-8-10-26-17(12-14)13(2)3/h4,8,10,12-13,15-16,18,20,24,27H,1,5-7,9,11H2,2-3H3,(H,28,32)(H,29,33)(H,30,34)/t15-,16+,18?,20?,24?/m0/s1 |
| InChIKey | BSYMRHUSXWDVHM-IJDALRHUSA-N |
| XLogP | 2.34 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|