C30H34N6O4S — CID 156600648
7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600648) has the molecular formula C30H34N6O4S and a molecular weight of 574.71 g/mol. Its IUPAC name is 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600648 |
| Molecular Formula | C30H34N6O4S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1NC(=O)C1=C2NC(=O)N(c3cnc(Oc4ccccc4)cc3C)C3CCNC(S1)C23 |
| InChI | InChI=1S/C30H34N6O4S/c1-3-23(37)33-19-11-7-8-12-20(19)34-28(38)27-26-25-21(13-14-31-29(25)41-27)36(30(39)35-26)22-16-32-24(15-17(22)2)40-18-9-5-4-6-10-18/h3-6,9-10,15-16,19-21,25,29,31H,1,7-8,11-14H2,2H3,(H,33,37)(H,34,38)(H,35,39)/t19-,20+,21?,25?,29?/m0/s1 |
| InChIKey | FUCDYJGNURQBMW-XNCWFERSSA-N |
| XLogP | 3.70 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|