C28H32N6O4S — CID 156600798
N-[(1R,2S)-2-acetamidocyclopentyl]-7-(2-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600798) has the molecular formula C28H32N6O4S and a molecular weight of 548.67 g/mol. Its IUPAC name is N-[(1R,2S)-2-acetamidocyclopentyl]-7-(2-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-acetamidocyclopentyl]-7-(2-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600798 |
| Molecular Formula | C28H32N6O4S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[(1R,2S)-2-acetamidocyclopentyl]-7-(2-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | CC(=O)N[C@H]1CCC[C@H]1NC(=O)C1=C2NC(=O)N(c3ccc(Oc4ccccc4)nc3C)C3CCNC(S1)C23 |
| InChI | InChI=1S/C28H32N6O4S/c1-15-20(11-12-22(30-15)38-17-7-4-3-5-8-17)34-21-13-14-29-27-23(21)24(33-28(34)37)25(39-27)26(36)32-19-10-6-9-18(19)31-16(2)35/h3-5,7-8,11-12,18-19,21,23,27,29H,6,9-10,13-14H2,1-2H3,(H,31,35)(H,32,36)(H,33,37)/t18-,19+,21?,23?,27?/m0/s1 |
| InChIKey | VSKNRUCISIBPRK-LFUNGNBXSA-N |
| XLogP | 3.15 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |