C26H29N5O3S — CID 156600589
N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600589) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600589 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | N[C@H]1CCC[C@H]1NC(=O)C1=C2NC(=O)N(c3ccc(Oc4ccccc4)cc3)C3CCNC(S1)C23 |
| InChI | InChI=1S/C26H29N5O3S/c27-18-7-4-8-19(18)29-24(32)23-22-21-20(13-14-28-25(21)35-23)31(26(33)30-22)15-9-11-17(12-10-15)34-16-5-2-1-3-6-16/h1-3,5-6,9-12,18-21,25,28H,4,7-8,13-14,27H2,(H,29,32)(H,30,33)/t18-,19+,20?,21?,25?/m0/s1 |
| InChIKey | GDSYNQWATMLLSD-DXTHOVSUSA-N |
| XLogP | 3.27 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |