C27H32N6O3S — CID 156600822
N-[(1R,2S)-2-aminocyclohexyl]-7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600822) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[(1R,2S)-2-aminocyclohexyl]-7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-aminocyclohexyl]-7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600822 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[(1R,2S)-2-aminocyclohexyl]-7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ncc1N1C(=O)NC2=C(C(=O)N[C@@H]3CCCC[C@@H]3N)SC3NCCC1C23 |
| InChI | InChI=1S/C27H32N6O3S/c1-15-13-21(36-16-7-3-2-4-8-16)30-14-20(15)33-19-11-12-29-26-22(19)23(32-27(33)35)24(37-26)25(34)31-18-10-6-5-9-17(18)28/h2-4,7-8,13-14,17-19,22,26,29H,5-6,9-12,28H2,1H3,(H,31,34)(H,32,35)/t17-,18+,19?,22?,26?/m0/s1 |
| InChIKey | AIQKTVZEHGCXFP-FSISFWEPSA-N |
| XLogP | 3.36 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |