C29H32N6O4S — CID 156600807
7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,3S)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600807) has the molecular formula C29H32N6O4S and a molecular weight of 560.68 g/mol. Its IUPAC name is 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,3S)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,3S)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600807 |
| Molecular Formula | C29H32N6O4S |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(1R,3S)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CC[C@@H](NC(=O)C2=C3NC(=O)N(c4cnc(Oc5ccccc5)cc4C)C4CCNC(S2)C34)C1 |
| InChI | InChI=1S/C29H32N6O4S/c1-3-22(36)32-17-9-10-18(14-17)33-27(37)26-25-24-20(11-12-30-28(24)40-26)35(29(38)34-25)21-15-31-23(13-16(21)2)39-19-7-5-4-6-8-19/h3-8,13,15,17-18,20,24,28,30H,1,9-12,14H2,2H3,(H,32,36)(H,33,37)(H,34,38)/t17-,18+,20?,24?,28?/m0/s1 |
| InChIKey | ZKFUFHLHLSMHPK-KQHFKHPJSA-N |
| XLogP | 3.31 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|