C29H32N6O3S — CID 156600742
6-oxo-7-(2-phenyl-4-pyridinyl)-N-[(1S,3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600742) has the molecular formula C29H32N6O3S and a molecular weight of 544.68 g/mol. Its IUPAC name is 6-oxo-7-(2-phenyl-4-pyridinyl)-N-[(1S,3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 6-oxo-7-(2-phenyl-4-pyridinyl)-N-[(1S,3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600742 |
| Molecular Formula | C29H32N6O3S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 6-oxo-7-(2-phenyl-4-pyridinyl)-N-[(1S,3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H](NC(=O)C2=C3NC(=O)N(c4ccnc(-c5ccccc5)c4)C4CCNC(S2)C34)C1 |
| InChI | InChI=1S/C29H32N6O3S/c1-2-23(36)32-18-9-6-10-19(15-18)33-27(37)26-25-24-22(12-14-31-28(24)39-26)35(29(38)34-25)20-11-13-30-21(16-20)17-7-4-3-5-8-17/h2-5,7-8,11,13,16,18-19,22,24,28,31H,1,6,9-10,12,14-15H2,(H,32,36)(H,33,37)(H,34,38)/t18-,19-,22?,24?,28?/m0/s1 |
| InChIKey | TWLKMVBMMPCLGU-VZWGOOQPSA-N |
| XLogP | 3.27 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|