C15H17F3N2O3S — CID 156601673
N-[2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-5-yl]methanesulfonamide (PubChem CID 156601673) has the molecular formula C15H17F3N2O3S and a molecular weight of 362.37 g/mol. Its IUPAC name is N-[2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-5-yl]methanesulfonamide.
| Compound Name | N-[2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 156601673 |
| Molecular Formula | C15H17F3N2O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-[2-[2-(trifluoromethyl)benzoyl]-2-azabicyclo[2.2.1]heptan-5-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CC2CC1CN2C(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2O3S/c1-24(22,23)19-13-7-10-6-9(13)8-20(10)14(21)11-4-2-3-5-12(11)15(16,17)18/h2-5,9-10,13,19H,6-8H2,1H3 |
| InChIKey | PTAZFIXZGARROR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |