C21H21N3O4 — CID 156601988
6-benzamido-N-(1,3-benzodioxol-5-yl)-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 156601988) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 6-benzamido-N-(1,3-benzodioxol-5-yl)-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 6-benzamido-N-(1,3-benzodioxol-5-yl)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 156601988 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 6-benzamido-N-(1,3-benzodioxol-5-yl)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NC1CC2CC1N(C(=O)Nc1ccc3c(c1)OCO3)C2)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c25-20(14-4-2-1-3-5-14)23-16-8-13-9-17(16)24(11-13)21(26)22-15-6-7-18-19(10-15)28-12-27-18/h1-7,10,13,16-17H,8-9,11-12H2,(H,22,26)(H,23,25) |
| InChIKey | BKIQWZOQTQZZQK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |