C22H25N3O2 — CID 91903403
(1R,4R,6S)-6-benzamido-N-(3-ethylphenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 91903403) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (1R,4R,6S)-6-benzamido-N-(3-ethylphenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,4R,6S)-6-benzamido-N-(3-ethylphenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 91903403 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (1R,4R,6S)-6-benzamido-N-(3-ethylphenyl)-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCc1cccc(NC(=O)N2C[C@@H]3C[C@H](NC(=O)c4ccccc4)[C@H]2C3)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-2-15-7-6-10-18(11-15)23-22(27)25-14-16-12-19(20(25)13-16)24-21(26)17-8-4-3-5-9-17/h3-11,16,19-20H,2,12-14H2,1H3,(H,23,27)(H,24,26)/t16-,19+,20-/m1/s1 |
| InChIKey | GMJGCRUFDRKHGX-LSTHTHJFSA-N |
| XLogP | 3.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |