About 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile
3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile (PubChem CID 156602763) has the molecular formula C16H22N2OS
and a molecular weight of 290.43 g/mol. Its IUPAC name is 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile |
| PubChem CID | 156602763 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile |
| SMILES | N#CCC[C@@H]1CC[C@]2(CCCN(Cc3cccs3)C2)O1 |
| InChI | InChI=1S/C16H22N2OS/c17-9-1-4-14-6-8-16(19-14)7-3-10-18(13-16)12-15-5-2-11-20-15/h2,5,11,14H,1,3-4,6-8,10,12-13H2/t14-,16+/m1/s1 |
| InChIKey | YKBVYEYHBGNCEU-ZBFHGGJFSA-N |
| XLogP | 3.57 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile?
The IUPAC name of 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile (CID 156602763) is 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile.
What is the SMILES notation for 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile?
The canonical SMILES for 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile is N#CCC[C@@H]1CC[C@]2(CCCN(Cc3cccs3)C2)O1.
What is the InChIKey of 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile?
The InChIKey is YKBVYEYHBGNCEU-ZBFHGGJFSA-N. The full InChI is InChI=1S/C16H22N2OS/c17-9-1-4-14-6-8-16(19-14)7-3-10-18(13-16)12-15-5-2-11-20-15/h2,5,11,14H,1,3-4,6-8,10,12-13H2/t14-,16+/m1/s1.
What are the key properties of 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile?
3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile has a molecular weight of 290.43 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,5S)-9-(thiophen-2-ylmethyl)-1-oxa-9-azaspiro[4.5]decan-2-yl]propanenitrile is sourced from PubChem (CID 156602763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).