C6HCl3O2 — CID 15660708
3,4,5-trichlorocyclohexa-3,5-diene-1,2-dione (PubChem CID 15660708) has the molecular formula C6HCl3O2 and a molecular weight of 211.43 g/mol. Its IUPAC name is 3,4,5-trichlorocyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3,4,5-trichlorocyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 15660708 |
| Molecular Formula | C6HCl3O2 |
| Molecular Weight | 211.43 g/mol |
| Exact Mass | 209.90 |
| IUPAC Name | 3,4,5-trichlorocyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=C(Cl)C(Cl)=C(Cl)C1=O |
| InChI | InChI=1S/C6HCl3O2/c7-2-1-3(10)6(11)5(9)4(2)8/h1H |
| InChIKey | VKLDSPFSVBLMNE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|