C6H3Cl3O — CID 67085825
2,4,6-trichlorocyclohexa-2,4-dien-1-one (PubChem CID 67085825) has the molecular formula C6H3Cl3O and a molecular weight of 197.45 g/mol. Its IUPAC name is 2,4,6-trichlorocyclohexa-2,4-dien-1-one.
| Compound Name | 2,4,6-trichlorocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 67085825 |
| Molecular Formula | C6H3Cl3O |
| Molecular Weight | 197.45 g/mol |
| Exact Mass | 195.92 |
| IUPAC Name | 2,4,6-trichlorocyclohexa-2,4-dien-1-one |
| SMILES | O=C1C(Cl)=CC(Cl)=CC1Cl |
| InChI | InChI=1S/C6H3Cl3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,4H |
| InChIKey | RDAIOCIPSFOYKE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|