C15H17N5O3 — CID 156608301
N-(2-oxabicyclo[3.2.0]heptan-6-yl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide (PubChem CID 156608301) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(2-oxabicyclo[3.2.0]heptan-6-yl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide.
| Compound Name | N-(2-oxabicyclo[3.2.0]heptan-6-yl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 156608301 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-(2-oxabicyclo[3.2.0]heptan-6-yl)-2-[3-(tetrazol-1-yl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(-n2cnnn2)c1)NC1CC2OCCC12 |
| InChI | InChI=1S/C15H17N5O3/c21-15(17-13-7-14-12(13)4-5-22-14)8-23-11-3-1-2-10(6-11)20-9-16-18-19-20/h1-3,6,9,12-14H,4-5,7-8H2,(H,17,21) |
| InChIKey | QENJBZPKOURACE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |