C16H20N2O3 — CID 156608737
3-(1,3-benzodioxol-5-ylmethyl)-3,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 156608737) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethyl)-3,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethyl)-3,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 156608737 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethyl)-3,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1NC2CCCC1CN(Cc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C16H20N2O3/c19-16-12-2-1-3-13(17-16)9-18(8-12)7-11-4-5-14-15(6-11)21-10-20-14/h4-6,12-13H,1-3,7-10H2,(H,17,19) |
| InChIKey | LNDSLQPUVGJEFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |