C20H25N3O5S — CID 156610509
13-(2,5-dimethoxyphenyl)sulfonyl-5-ethyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one (PubChem CID 156610509) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 13-(2,5-dimethoxyphenyl)sulfonyl-5-ethyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one.
| Compound Name | 13-(2,5-dimethoxyphenyl)sulfonyl-5-ethyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
|---|---|
| PubChem CID | 156610509 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 13-(2,5-dimethoxyphenyl)sulfonyl-5-ethyl-4,6,13-triazatricyclo[8.2.1.03,8]trideca-3(8),4-dien-7-one |
| SMILES | CCc1nc2c(c(=O)[nH]1)CC1CCC(C2)N1S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H25N3O5S/c1-4-19-21-16-10-13-6-5-12(9-15(16)20(24)22-19)23(13)29(25,26)18-11-14(27-2)7-8-17(18)28-3/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,21,22,24) |
| InChIKey | STEKBIVHETXEAD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |