C22H30ClN3O4 — CID 156612236
4-[2-(4-chlorophenyl)acetyl]-1-(2-methoxyacetyl)-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one (PubChem CID 156612236) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)acetyl]-1-(2-methoxyacetyl)-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one.
| Compound Name | 4-[2-(4-chlorophenyl)acetyl]-1-(2-methoxyacetyl)-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one |
|---|---|
| PubChem CID | 156612236 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 4-[2-(4-chlorophenyl)acetyl]-1-(2-methoxyacetyl)-3,5,6,7,8a,9,10,11,12,12a-decahydro-2H-benzo[h][1,4,7]triazecin-8-one |
| SMILES | COCC(=O)N1CCN(C(=O)Cc2ccc(Cl)cc2)CCNC(=O)C2CCCCC21 |
| InChI | InChI=1S/C22H30ClN3O4/c1-30-15-21(28)26-13-12-25(20(27)14-16-6-8-17(23)9-7-16)11-10-24-22(29)18-4-2-3-5-19(18)26/h6-9,18-19H,2-5,10-15H2,1H3,(H,24,29) |
| InChIKey | UDXODUOQZVSORB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |