C34H34ClN3O3 — CID 156612852
2-[4-[[[(1S,13R)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl]amino]methyl]phenyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]acetamide (PubChem CID 156612852) has the molecular formula C34H34ClN3O3 and a molecular weight of 568.12 g/mol. Its IUPAC name is 2-[4-[[[(1S,13R)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl]amino]methyl]phenyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[4-[[[(1S,13R)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl]amino]methyl]phenyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 156612852 |
| Molecular Formula | C34H34ClN3O3 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 2-[4-[[[(1S,13R)-7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl]amino]methyl]phenyl]-N-[(4-hydroxy-3-methoxyphenyl)methyl]acetamide |
| SMILES | COc1cc(CNC(=O)Cc2ccc(CNc3c4c(nc5cc(Cl)ccc35)C[C@H]3CC(C)=C[C@@H]4C3)cc2)ccc1O |
| InChI | InChI=1S/C34H34ClN3O3/c1-20-11-24-13-25(12-20)33-29(14-24)38-28-17-26(35)8-9-27(28)34(33)37-18-22-5-3-21(4-6-22)16-32(40)36-19-23-7-10-30(39)31(15-23)41-2/h3-10,12,15,17,24-25,39H,11,13-14,16,18-19H2,1-2H3,(H,36,40)(H,37,38)/t24-,25+/m0/s1 |
| InChIKey | BWBXSBFNPJZWIY-LOSJGSFVSA-N |
| XLogP | 7.07 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|