C32H35ClN2O3 — CID 118720934
(E)-8-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl)amino]-1-(4-hydroxy-3-methoxyphenyl)oct-4-en-3-one (PubChem CID 118720934) has the molecular formula C32H35ClN2O3 and a molecular weight of 531.10 g/mol. Its IUPAC name is (E)-8-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl)amino]-1-(4-hydroxy-3-methoxyphenyl)oct-4-en-3-one.
| Compound Name | (E)-8-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl)amino]-1-(4-hydroxy-3-methoxyphenyl)oct-4-en-3-one |
|---|---|
| PubChem CID | 118720934 |
| Molecular Formula | C32H35ClN2O3 |
| Molecular Weight | 531.10 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | (E)-8-[(7-chloro-15-methyl-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,15-hexaen-3-yl)amino]-1-(4-hydroxy-3-methoxyphenyl)oct-4-en-3-one |
| SMILES | COc1cc(CCC(=O)/C=C/CCCNc2c3c(nc4cc(Cl)ccc24)CC2CC(C)=CC3C2)ccc1O |
| InChI | InChI=1S/C32H35ClN2O3/c1-20-14-22-16-23(15-20)31-28(17-22)35-27-19-24(33)9-11-26(27)32(31)34-13-5-3-4-6-25(36)10-7-21-8-12-29(37)30(18-21)38-2/h4,6,8-9,11-12,15,18-19,22-23,37H,3,5,7,10,13-14,16-17H2,1-2H3,(H,34,35)/b6-4+ |
| InChIKey | XLIOMHFQNGCWAV-GQCTYLIASA-N |
| XLogP | 7.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.10 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|