C20H21ClO4 — CID 141198589
1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethylpentane-1,3-dione (PubChem CID 141198589) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethylpentane-1,3-dione.
| Compound Name | 1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 141198589 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(4-hydroxy-3-methoxyphenyl)-2,2-dimethylpentane-1,3-dione |
| SMILES | COc1cc(CCC(=O)C(C)(C)C(=O)c2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C20H21ClO4/c1-20(2,19(24)14-6-8-15(21)9-7-14)18(23)11-5-13-4-10-16(22)17(12-13)25-3/h4,6-10,12,22H,5,11H2,1-3H3 |
| InChIKey | XWGJWIJKSNJZCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|