C22H29BrN3+ — CID 156613441
1-(5-bromo-3-pyridinyl)-4-[4-(3-methylphenyl)cyclohexyl]piperazin-4-ium (PubChem CID 156613441) has the molecular formula C22H29BrN3+ and a molecular weight of 415.40 g/mol. Its IUPAC name is 1-(5-bromo-3-pyridinyl)-4-[4-(3-methylphenyl)cyclohexyl]piperazin-4-ium.
| Compound Name | 1-(5-bromo-3-pyridinyl)-4-[4-(3-methylphenyl)cyclohexyl]piperazin-4-ium |
|---|---|
| PubChem CID | 156613441 |
| Molecular Formula | C22H29BrN3+ |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-(5-bromo-3-pyridinyl)-4-[4-(3-methylphenyl)cyclohexyl]piperazin-4-ium |
| SMILES | Cc1cccc([C@H]2CC[C@@H]([NH+]3CCN(c4cncc(Br)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C22H28BrN3/c1-17-3-2-4-19(13-17)18-5-7-21(8-6-18)25-9-11-26(12-10-25)22-14-20(23)15-24-16-22/h2-4,13-16,18,21H,5-12H2,1H3/p+1/t18-,21+ |
| InChIKey | GPGOZHVXQXMXPF-RVWIWJKTSA-O |
| XLogP | 3.58 |
| TPSA | 20.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |