C32H38N8O — CID 15662000
1-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-methyl-1-pentylurea (PubChem CID 15662000) has the molecular formula C32H38N8O and a molecular weight of 550.71 g/mol. Its IUPAC name is 1-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-methyl-1-pentylurea.
| Compound Name | 1-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-methyl-1-pentylurea |
|---|---|
| PubChem CID | 15662000 |
| Molecular Formula | C32H38N8O |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 1-[2-butyl-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazol-5-yl]-3-methyl-1-pentylurea |
| SMILES | CCCCCN(C(=O)NC)c1ccc2c(c1)nc(CCCC)n2Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C32H38N8O/c1-4-6-10-20-39(32(41)33-3)25-18-19-29-28(21-25)34-30(13-7-5-2)40(29)22-23-14-16-24(17-15-23)26-11-8-9-12-27(26)31-35-37-38-36-31/h8-9,11-12,14-19,21H,4-7,10,13,20,22H2,1-3H3,(H,33,41)(H,35,36,37,38) |
| InChIKey | YCTIYYICCMNMPH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|